CAS 113806-28-3
:(2R,4S)-3-Benzoyl-4-methyl-2-phenyl-5-oxazolidinone
Description:
(2R,4S)-3-Benzoyl-4-methyl-2-phenyl-5-oxazolidinone is a chiral oxazolidinone compound characterized by its unique stereochemistry and functional groups. The presence of the oxazolidinone ring imparts significant stability and reactivity, making it a valuable intermediate in organic synthesis, particularly in the pharmaceutical industry. The compound features a benzoyl group and a phenyl group, contributing to its aromatic character and potential for π-π interactions. Its chiral centers (2R and 4S) indicate that it exists in a specific stereoisomeric form, which can influence its biological activity and interactions with other molecules. This compound may exhibit properties such as solubility in organic solvents, moderate melting points, and potential for hydrogen bonding due to the carbonyl and nitrogen functionalities. Its applications may include use as a building block in drug development or as a ligand in asymmetric synthesis. Overall, the structural features of (2R,4S)-3-Benzoyl-4-methyl-2-phenyl-5-oxazolidinone make it an interesting subject for further research in medicinal chemistry and materials science.
Formula:C17H15NO3
InChI:InChI=1S/C17H15NO3/c1-12-17(20)21-16(14-10-6-3-7-11-14)18(12)15(19)13-8-4-2-5-9-13/h2-12,16H,1H3/t12-,16+/m0/s1
InChI key:XWBOGYZALFWLOF-BLLLJJGKSA-N
SMILES:C[C@H]1C(=O)O[C@@H](N1C(=O)C2=CC=CC=C2)C3=CC=CC=C3
Synonyms:- (2R-trans)-3-Benzoyl-4-methyl-2-phenyl-5-oxazolidinone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
5-Oxazolidinone, 3-benzoyl-4-methyl-2-phenyl-, (2R,4S)-
CAS:Formula:C17H15NO3Color and Shape:SolidMolecular weight:281.3059(2R,4S)-3-Benzoyl-4-methyl-2-phenyl-5-oxazolidinone
CAS:Controlled ProductFormula:C17H15NO3Color and Shape:NeatMolecular weight:281.31

