CymitQuimica logo

CAS 113822-11-0

:

N,N,N',N'-tetramethylethane-1,2-diamine-dimethylpalladium (1:1)

Description:
N,N,N',N'-Tetramethylethane-1,2-diamine-dimethylpalladium (1:1), with the CAS number 113822-11-0, is a coordination compound featuring a palladium center coordinated to a bidentate ligand, specifically N,N,N',N'-tetramethylethane-1,2-diamine. This compound typically exhibits characteristics associated with palladium complexes, such as catalytic activity in various organic reactions, including cross-coupling reactions. The presence of the dimethylpalladium moiety suggests potential applications in catalysis, particularly in the formation of carbon-carbon bonds. The ligand's structure, with its four methyl groups, contributes to the steric and electronic properties of the complex, influencing its reactivity and stability. Additionally, the compound may exhibit solubility in organic solvents, which is common for palladium complexes, making it suitable for use in synthetic organic chemistry. Safety and handling precautions should be observed due to the potential toxicity of palladium compounds and the amine ligand. Overall, this compound represents a valuable tool in the field of organometallic chemistry and catalysis.
Formula:C8H22N2Pd
InChI:InChI=1/C6H16N2.2CH3.Pd/c1-7(2)5-6-8(3)4;;;/h5-6H2,1-4H3;2*1H3;/rC6H16N2.C2H6Pd/c1-7(2)5-6-8(3)4;1-3-2/h5-6H2,1-4H3;1-2H3
InChI key:MVFJYGIWWVNQPQ-UHFFFAOYSA-N
SMILES:CN(C)CCN(C)C.C[Pd]C
Synonyms:
  • N1
  • Cis-Dimethyl(N,N,N',N'-Tetramethylethylenediamine)Palladium(Ii)
Found 4 products.