CymitQuimica logo

CAS 1138444-24-2

:

3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxylic acid

Description:
3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxylic acid is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features a carboxylic acid functional group, which enhances its solubility in polar solvents and allows for potential interactions in biological systems. The presence of the methyl group at the 3-position of the imidazole ring influences its electronic properties and steric hindrance, potentially affecting its reactivity and binding affinity in biochemical contexts. The compound is of interest in medicinal chemistry, particularly for its potential applications in drug development, as it may exhibit biological activity against various targets. Its structural characteristics suggest that it could participate in hydrogen bonding and π-π stacking interactions, which are crucial for molecular recognition processes. Overall, 3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxylic acid represents a versatile scaffold for further chemical modifications and investigations in pharmaceutical research.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c1-11-4-10-6-2-5(8(12)13)3-9-7(6)11/h2-4H,1H3,(H,12,13)
InChI key:InChIKey=GPELOYZLVAHJOP-UHFFFAOYSA-N
SMILES:CN1C=2C(=CC(C(O)=O)=CN2)N=C1
Synonyms:
  • 3-Methyl-3H-imidazo[4,5-b]pyridine-6-carboxylic acid
  • 3H-Imidazo[4,5-b]pyridine-6-carboxylic acid, 3-methyl-
Found 3 products.