CymitQuimica logo

CAS 1138444-80-0

:

4'-Cyano-3'-methylacetophenone

Description:
4'-Cyano-3'-methylacetophenone, with the CAS number 1138444-80-0, is an organic compound characterized by its functional groups and structural features. It belongs to the class of ketones and is notable for the presence of both a cyano group (-CN) and a methyl group (-CH3) attached to the aromatic ring. This compound typically exhibits a crystalline solid form and is soluble in organic solvents, reflecting its non-polar characteristics. The cyano group contributes to its reactivity, making it useful in various chemical syntheses, including the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit interesting photophysical properties, which can be leveraged in materials science applications. Its molecular structure allows for potential interactions in biological systems, although specific biological activity would depend on further studies. As with many organic compounds, handling should be done with care, considering safety data sheets for proper guidelines on toxicity and environmental impact.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c1-7-5-9(8(2)12)3-4-10(7)6-11/h3-5H,1-2H3
InChI key:LWNRBRVWBVQQIF-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C(=O)C)C#N
Found 3 products.