CymitQuimica logo

CAS 1138444-85-5

:

2-Bromo-4-(1,1-difluoroethyl)-1-fluorobenzene

Description:
2-Bromo-4-(1,1-difluoroethyl)-1-fluorobenzene is an organic compound characterized by the presence of a bromine atom, a fluorine atom, and a difluoroethyl group attached to a benzene ring. This compound features a substituted aromatic structure, which contributes to its chemical reactivity and physical properties. The presence of multiple halogen atoms, specifically bromine and fluorine, typically enhances the compound's lipophilicity and may influence its boiling and melting points, making it useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the difluoroethyl group can impart unique electronic properties, affecting the compound's behavior in chemical reactions. The compound's molecular structure suggests potential applications in synthetic chemistry, particularly in the development of fluorinated compounds, which are often sought after for their stability and unique reactivity. Safety and handling considerations are important due to the presence of halogens, which can pose health and environmental risks. As with any chemical substance, proper safety protocols should be followed when working with 2-Bromo-4-(1,1-difluoroethyl)-1-fluorobenzene.
Formula:C8H6BrF3
InChI:InChI=1S/C8H6BrF3/c1-8(11,12)5-2-3-7(10)6(9)4-5/h2-4H,1H3
InChI key:InChIKey=TXLFKKQZPURBRK-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C1=CC(Br)=C(F)C=C1
Synonyms:
  • 2-Bromo-4-(1,1-difluoroethyl)-1-fluorobenzene
  • Benzene, 2-bromo-4-(1,1-difluoroethyl)-1-fluoro-
Found 3 products.