CymitQuimica logo

CAS 1138444-94-6

:

1-Chloro-4-(1,1-difluoroethyl)-2-(trifluoromethyl)benzene

Description:
1-Chloro-4-(1,1-difluoroethyl)-2-(trifluoromethyl)benzene is an organic compound characterized by its aromatic structure, featuring a chlorobenzene core substituted with both a trifluoromethyl group and a difluoroethyl group. The presence of the chlorine atom and multiple fluorine atoms contributes to its unique chemical properties, including increased lipophilicity and potential reactivity in various chemical reactions. This compound is likely to exhibit significant volatility and stability under standard conditions, making it of interest in both industrial applications and research settings. Its fluorinated substituents may impart specific characteristics such as enhanced thermal stability and resistance to degradation. Additionally, the compound's structure suggests potential uses in agrochemicals, pharmaceuticals, or as an intermediate in organic synthesis. Safety and handling considerations are important due to the presence of halogens, which can pose environmental and health risks. Overall, 1-Chloro-4-(1,1-difluoroethyl)-2-(trifluoromethyl)benzene represents a complex and versatile chemical entity within the realm of fluorinated organic compounds.
Formula:C9H6ClF5
InChI:InChI=1S/C9H6ClF5/c1-8(11,12)5-2-3-7(10)6(4-5)9(13,14)15/h2-4H,1H3
InChI key:InChIKey=XXRFAXKQLBZEOB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(C)(F)F)=CC=C1Cl
Synonyms:
  • 1-Chloro-4-(1,1-difluoroethyl)-2-(trifluoromethyl)benzene
  • Benzene, 1-chloro-4-(1,1-difluoroethyl)-2-(trifluoromethyl)-
Found 1 products.