CAS 113900-75-7

Formula: C20H22N2O2

InChI: InChI=1S/C20H22N2O2/c1-3-19-11-22(2,23)16-9-20(19)13-6-4-5-7-15(13)21-18(20)17-8-14(19)12(16)10-24-17/h3-7,12,14,16-17H,1,8-11H2,2H3

InChI key: OISZCFMVBRTVHR-UHFFFAOYSA-N

SMILES: C[N+]1(CC2(C3CC4C5=NC6=CC=CC=C6C52CC1C3CO4)C=C)[O-]

Koumine N-oxide

CAS: 113900-75-7

Formula: C₂₀H₂₂N₂O₂

Purity: 96.0%

Molecular weight: 322.4009

Ref: IN-DA008YBB

Koumine N-oxide

CAS: 113900-75-7

Koumine N-oxide is a natural product from Gelsemium elegans.

Formula: C₂₀H₂₂N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 322.4009

Ref: TM-TN4396

Koumine N-oxide

CAS: 113900-75-7

Formula: C₂₀H₂₂N₂O₂

Purity: 95%~99%

Color and Shape: Powder

Molecular weight: 322.408

Ref: BP-SBP02626

Koumine N-oxide

Controlled Product

CAS: 113900-75-7

Koumine N-oxide is a natural alkaloid, which is primarily sourced from the Gelsemium plant, known for its traditional medicinal uses. The mode of action of Koumine N-oxide involves interacting with specific molecular targets in the body, influencing neural pathways and demonstrating potential therapeutic effects.

Formula: C₂₀H₂₂N₂O₂

Purity: Min. 95%

Molecular weight: 322.4 g/mol

Ref: 3D-NEA90075