CymitQuimica logo

CAS 113948-79-1

:

Silane, [[(2Z)-4-chloro-2-butenyl]oxy](1,1-dimethylethyl)dimethyl-

Description:
Silane, [(2Z)-4-chloro-2-butenyl]oxy](1,1-dimethylethyl)dimethyl- is a chemical compound characterized by its silane functional group, which contains silicon bonded to organic groups. This compound features a chloro-substituted butenyl moiety, indicating the presence of a double bond and a chlorine atom, which can influence its reactivity and stability. The presence of dimethyl and tert-butyl groups suggests steric hindrance, potentially affecting its interactions with other molecules. Silanes are often used in various applications, including as coupling agents in polymer chemistry, surface modifiers, and precursors in the synthesis of silicon-based materials. The specific structure of this silane may impart unique properties, such as enhanced adhesion or compatibility with different substrates. Additionally, the presence of the chloro group may introduce reactivity that can be exploited in further chemical transformations. Overall, this compound exemplifies the diverse chemistry of silanes and their utility in both industrial and research settings.
Formula:C10H21ClOSi
InChI:InChI=1S/C10H21ClOSi/c1-10(2,3)13(4,5)12-9-7-6-8-11/h6-7H,8-9H2,1-5H3
InChI key:GVMKGJGEWZQVTQ-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C)(C)OCC=CCCl
Found 1 products.