CAS 113995-55-4
:1H-Benz[e]indole-7-sulfonic acid, 1,1,2-trimethyl-
Description:
1H-Benz[e]indole-7-sulfonic acid, 1,1,2-trimethyl- is an organic compound characterized by its complex structure, which includes a benz[e]indole core and a sulfonic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its stability and reactivity. The presence of the sulfonic acid group suggests that it is likely to be soluble in water and may exhibit acidic behavior, making it useful in various chemical applications, including as a reagent or in dye synthesis. The trimethyl substituents on the indole structure can influence its electronic properties and steric hindrance, potentially affecting its interactions in biological systems or materials science. Additionally, compounds like this may have applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. As with many sulfonic acids, it may also exhibit good thermal stability and resistance to oxidation, making it suitable for various industrial processes.
Formula:C15H15NO3S
InChI:InChI=1S/C15H15NO3S/c1-9-15(2,3)14-12-6-5-11(20(17,18)19)8-10(12)4-7-13(14)16-9/h4-8H,1-3H3,(H,17,18,19)
InChI key:FARITYWNMPFIJN-UHFFFAOYSA-N
SMILES:CC1=NC2=C(C1(C)C)C3=C(C=C2)C=C(C=C3)S(=O)(=O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
