CAS 113997-55-0
:4-BENZYLOXYINDOLE-3-ACETONE
Description:
4-Benzyloxyindole-3-acetone is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a benzyloxy group at the 4-position of the indole and an acetone moiety at the 3-position, contributing to its unique reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the benzyloxy group can enhance its lipophilicity, potentially influencing its biological activity and interactions. This compound is of interest in medicinal chemistry and research due to its potential pharmacological properties, including effects on various biological pathways. As with many indole derivatives, it may also exhibit fluorescence, making it useful in biochemical assays. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper laboratory practices.
Formula:C18H17NO2
InChI:InChI=1S/C18H17NO2/c1-13(20)10-15-11-19-16-8-5-9-17(18(15)16)21-12-14-6-3-2-4-7-14/h2-9,11,19H,10,12H2,1H3
InChI key:BMFUYDUSMLVBHB-UHFFFAOYSA-N
SMILES:CC(=O)CC1=CNC2=C1C(=CC=C2)OCC3=CC=CC=C3
Synonyms:- 4-Benzyloxyindole-3-Propanone
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
