CymitQuimica logo

CAS 114012-05-4

:

2-(2-phenoxyethoxy)aniline

Description:
2-(2-Phenoxyethoxy)aniline, identified by its CAS number 114012-05-4, is an organic compound characterized by its aniline structure, which features an amino group (-NH2) attached to a benzene ring. This compound contains a phenoxyethoxy substituent, indicating the presence of both ether and phenyl functionalities. It is typically a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. The presence of the ether linkage contributes to its solubility in organic solvents, while the aniline moiety can participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic reactions. This compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its properties, such as melting point, boiling point, and reactivity, can vary based on the specific formulation and environmental conditions. Safety data should be consulted for handling and potential hazards, as compounds with amine groups can be sensitive to oxidation and may pose health risks if not managed properly.
Formula:C14H15NO2
InChI:InChI=1/C14H15NO2/c15-13-8-4-5-9-14(13)17-11-10-16-12-6-2-1-3-7-12/h1-9H,10-11,15H2
InChI key:OWCFHGUDMYDGPA-UHFFFAOYSA-N
SMILES:c1ccc(cc1)OCCOc1ccccc1N
Found 2 products.