CymitQuimica logo

CAS 114040-06-1

:

Pyrazolo[1,5-a]pyrimidine, 3-bromo-5,7-dichloro-

Description:
Pyrazolo[1,5-a]pyrimidine, 3-bromo-5,7-dichloro- is a heterocyclic compound characterized by a fused pyrazole and pyrimidine ring system. This compound features bromine and chlorine substituents, which can significantly influence its chemical reactivity and biological activity. The presence of halogens often enhances the lipophilicity and can affect the compound's interaction with biological targets, making it of interest in medicinal chemistry. Pyrazolo[1,5-a]pyrimidines are known for their diverse pharmacological properties, including potential anti-inflammatory, anti-cancer, and anti-viral activities. The specific arrangement of the bromine and chlorine atoms at the 3, 5, and 7 positions contributes to the compound's unique electronic and steric properties. Additionally, the compound's stability, solubility, and reactivity can be influenced by these substituents, making it a subject of interest for further research in drug development and synthetic chemistry. Overall, this compound exemplifies the complexity and utility of halogenated heterocycles in various chemical applications.
Formula:C6H2BrCl2N3
InChI:InChI=1/C6H2BrCl2N3/c7-3-2-10-12-5(9)1-4(8)11-6(3)12/h1-2H
InChI key:CJIKMWXLGRVJMI-UHFFFAOYSA-N
SMILES:c1c(Cl)nc2c(cnn2c1Cl)Br
Synonyms:
  • 3-Bromo-5,7-dichloropyrazolo[1,5-a]pyrimidine
Found 4 products.