CymitQuimica logo

CAS 114058-79-6

:

7-Quinolinamine,4-methyl-(9CI)

Description:
7-Quinolinamine, 4-methyl- (9CI), with the CAS number 114058-79-6, is an organic compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features an amino group (-NH2) at the 7-position and a methyl group (-CH3) at the 4-position of the quinoline ring. It is typically a solid at room temperature and may exhibit properties such as solubility in organic solvents and limited solubility in water, depending on the specific conditions. The presence of the amino group suggests potential basicity and reactivity, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C10H10N2
InChI:InChI=1S/C10H10N2/c1-7-4-5-12-10-6-8(11)2-3-9(7)10/h2-6H,11H2,1H3
InChI key:MEWHVQCJPFDWIO-UHFFFAOYSA-N
SMILES:CC1=C2C=CC(=CC2=NC=C1)N
Found 3 products.