CymitQuimica logo

CAS 114076-35-6

:

3,4-Difluoro-2-methoxyaniline

Description:
3,4-Difluoro-2-methoxyaniline is an organic compound characterized by the presence of two fluorine atoms and a methoxy group attached to an aniline structure. Its molecular formula typically includes carbon, hydrogen, nitrogen, and fluorine, reflecting its aromatic nature due to the aniline component. The compound features a methoxy (-OCH₃) group, which can influence its solubility and reactivity. The fluorine substituents enhance the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. 3,4-Difluoro-2-methoxyaniline is often utilized in various chemical syntheses and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other functional materials. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or environmental impact.
Formula:C7H7F2NO
InChI:InChI=1/C7H7F2NO/c1-11-7-5(10)3-2-4(8)6(7)9/h2-3H,10H2,1H3
InChI key:OHHHWQYSRANYIX-UHFFFAOYSA-N
SMILES:COc1c(ccc(c1F)F)N
Synonyms:
  • Benzenamine, 3,4-difluoro-2-methoxy- (9CI)
  • 6-Amino-2,3-difluoroanisole
Found 5 products.