CAS 114086-14-5
:2-BENZYL-2,5-DIAZA-BICYCLO[2,2,1]HEPTANE
Description:
2-Benzyl-2,5-diaza-bicyclo[2.2.1]heptane is a bicyclic organic compound characterized by its unique structure, which includes two nitrogen atoms incorporated into a bicyclic framework. This compound features a benzyl group attached to one of the nitrogen atoms, contributing to its chemical properties and potential applications. The bicyclic structure provides rigidity, which can influence its reactivity and interaction with biological systems. As a diaza compound, it may exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds. The presence of the benzyl group can enhance lipophilicity, potentially affecting its solubility in organic solvents and biological membranes. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could lead to interactions with various biological targets. However, specific data regarding its physical properties, reactivity, and biological activity would require further investigation through experimental studies.
Formula:C12H16N2
InChI:InChI=1S/C12H16N2/c1-2-4-10(5-3-1)8-14-9-11-6-12(14)7-13-11/h1-5,11-13H,6-9H2
InChI key:JPRFUVVWNBBEDI-UHFFFAOYSA-N
SMILES:C1C2CNC1CN2CC3=CC=CC=C3
Synonyms:- 2,5-Diazabicyclo[2.2.1]heptane,2-(phenylmethyl)-(9CI)
- 2-Benzyl-2,5-Diazabicyclo[2,2,1]Heptane,98%
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
