CAS 1141-23-7
:β-(2-Amino-2-oxoethyl)-4-chlorobenzenepropanoic acid
Description:
β-(2-Amino-2-oxoethyl)-4-chlorobenzenepropanoic acid, also known by its CAS number 1141-23-7, is an organic compound characterized by its structure, which includes an amino group, a carbonyl group, and a chlorobenzene moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the amino and carboxylic acid functional groups. It may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions, owing to its functional groups. The chlorobenzene ring can influence its reactivity and stability, while the amino and carboxylic acid groups can engage in hydrogen bonding, affecting its physical properties like melting point and boiling point. This compound may have applications in pharmaceuticals or as an intermediate in organic synthesis, although specific uses would depend on further research and development. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C11H12ClNO3
InChI:InChI=1S/C11H12ClNO3/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H2,13,14)(H,15,16)
InChI key:InChIKey=NLCJVRPOYTZTMS-UHFFFAOYSA-N
SMILES:C(CC(N)=O)(CC(O)=O)C1=CC=C(Cl)C=C1
Synonyms:- 3-(4-Chloro phenyl) Glutaric acid monoamide
- 3-(p-Chlorophenyl)glutaramic acid
- 5-Amino-3-(4-Chlorophenyl)-5-Oxopentanoic Acid
- Benzenepropanoic acid, β-(2-amino-2-oxoethyl)-4-chloro-
- Glutaramic acid, 3-(p-chlorophenyl)-
- β-(2-Amino-2-oxoethyl)-4-chlorobenzenepropanoic acid
- β-(4-chlorophenyl)Glutarimide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Benzenepropanoic acid, β-(2-amino-2-oxoethyl)-4-chloro-
CAS:Formula:C11H12ClNO3Purity:95%Color and Shape:SolidMolecular weight:241.6709Baclofen EP Impurity B
CAS:Formula:C11H12ClNO3Color and Shape:White To Off-White SolidMolecular weight:241.673-(4-Chlorophenyl)Glutaramic Acid
CAS:3-(4-Chlorophenyl)Glutaramic AcidFormula:C11H12ClNO3Purity:98%Molecular weight:241.67(3RS)-5-Amino-3-(4-chlorophenyl)-5-oxopentanoic Acid
CAS:Formula:C11H12ClNO3Color and Shape:Off White SolidMolecular weight:241.673-(4-Chlorophenyl)glutaramic acid
CAS:3-(4-Chlorophenyl)glutaramic acid (3-PGA) is a nucleophilic compound that has been used for the treatment of trigeminal neuralgia. 3-PGA reacts with monomers, such as butanol and alkene, to form condensation products, which are then degraded by imine or additives. This process can be reversed by adding magnesium to the reaction mixture. 3-PGA is also used in polymerization reactions to produce copolymers from monomers like vinyl chloride and ethylene. The polymerization inhibitor 3-PGA prevents the formation of high molecular weight polymers that cannot be degraded by enzymes.Formula:C11H12ClNO3Purity:Min. 95%Color and Shape:PowderMolecular weight:241.67 g/mol5-Amino-3-(4-chlorophenyl)-5-oxopentanoic acid
CAS:Formula:C11H12ClNO3Purity:98%Color and Shape:SolidMolecular weight:241.673-(4-Chlorophenyl)glutaramic Acid
CAS:Controlled ProductFormula:C11H12ClNO3Color and Shape:NeatMolecular weight:241.67







