CymitQuimica logo

CAS 1141-24-8

:

3-(4-Bromophenyl)pentanedioic acid

Description:
3-(4-Bromophenyl)pentanedioic acid, with the CAS number 1141-24-8, is an organic compound characterized by its structure, which includes a pentanedioic acid backbone substituted with a bromophenyl group. This compound features two carboxylic acid functional groups (-COOH) at the first and fifth carbon positions of a five-carbon chain, making it a dicarboxylic acid. The presence of the bromophenyl group at the third carbon introduces significant polarity and can influence the compound's reactivity and solubility in various solvents. Typically, such compounds exhibit acidic properties due to the carboxylic acid groups, which can donate protons in solution. The bromine substituent can also affect the compound's electronic properties, potentially enhancing its reactivity in electrophilic substitution reactions. Additionally, 3-(4-Bromophenyl)pentanedioic acid may have applications in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Its physical properties, such as melting point and solubility, would depend on the specific conditions and purity of the sample.
Formula:C11H11BrO4
InChI:InChI=1S/C11H11BrO4/c12-9-3-1-7(2-4-9)8(5-10(13)14)6-11(15)16/h1-4,8H,5-6H2,(H,13,14)(H,15,16)
InChI key:InChIKey=ZSYRDSTUBZGDKI-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(CC(O)=O)C1=CC=C(Br)C=C1
Synonyms:
  • 3-(4-Bromophenyl)glutaric acid
  • 3-(4-Bromophenyl)pentanedioic acid
  • B-(4-Bromopheny1)Glutaric Acid
  • Glutaric acid, 3-(p-bromophenyl)-
  • Pentanedioic acid, 3-(4-bromophenyl)-
Found 4 products.