CymitQuimica logo

CAS 114138-49-7

:

1H-Pyrazol-5-ol, 1,3-diphenyl-

Description:
1H-Pyrazol-5-ol, 1,3-diphenyl- is an organic compound characterized by its pyrazole ring structure, which consists of a five-membered ring containing two adjacent nitrogen atoms. This compound features a hydroxyl group (-OH) at the 5-position and two phenyl groups attached to the 1 and 3 positions of the pyrazole ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The presence of the hydroxyl group suggests potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. This compound may be of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activity and ability to act as a ligand in coordination chemistry. Additionally, its structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C15H12N2O
InChI:InChI=1S/C15H12N2O/c18-15-11-14(12-7-3-1-4-8-12)16-17(15)13-9-5-2-6-10-13/h1-11,16H
InChI key:XUGMZXWEBJJQID-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CC(=O)N(N2)C3=CC=CC=C3
Found 1 products.