CymitQuimica logo

CAS 114144-16-0

:

6-IODO-2,3-DIHYDRO-1H-INDOLE

Description:
6-Iodo-2,3-dihydro-1H-indole is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of an iodine atom at the 6-position of the indole ring significantly influences its reactivity and properties. This compound is typically a solid at room temperature and may exhibit a range of colors depending on its purity and form. It is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with biological targets. The dihydro form indicates that it has two hydrogen atoms added to the double bond in the indole structure, which can affect its stability and reactivity. Additionally, the iodine substituent can enhance the compound's lipophilicity, potentially influencing its bioavailability and interaction with biological systems. As with many halogenated compounds, it may also exhibit unique electronic properties, making it of interest in various chemical synthesis and research applications.
Formula:C8H8IN
InChI:InChI=1/C8H8IN/c9-7-2-1-6-3-4-10-8(6)5-7/h1-2,5,10H,3-4H2
InChI key:AADZERKEXPUPGY-UHFFFAOYSA-N
SMILES:c1cc(cc2c1CCN2)I
Synonyms:
  • 1H-indole, 2,3-dihydro-6-iodo-
  • 6-Iodoindoline
Found 1 products.