CAS 114164-97-5
:2-METHYL-5-TRIFLUOROMETHOXYBENZIMIDAZOLE
Description:
2-Methyl-5-trifluoromethoxybenzimidazole is a chemical compound characterized by its unique structure, which includes a benzimidazole core substituted with a methyl group and a trifluoromethoxy group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the benzimidazole moiety, which is known for its role in various pharmaceuticals. The trifluoromethoxy group enhances lipophilicity and may influence the compound's reactivity and interaction with biological targets. Additionally, the presence of fluorine atoms often imparts unique electronic properties, potentially affecting the compound's stability and solubility. 2-Methyl-5-trifluoromethoxybenzimidazole may be utilized in research and development, particularly in medicinal chemistry, due to its potential applications in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C9H7F3N2O
InChI:InChI=1S/C9H7F3N2O/c1-5-13-7-3-2-6(4-8(7)14-5)15-9(10,11)12/h2-4H,1H3,(H,13,14)
InChI key:BSROJRWZJKELNS-UHFFFAOYSA-N
SMILES:CC1=NC2=C(N1)C=C(C=C2)OC(F)(F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-Methyl-5-(trifluoromethoxy)-1H-benzo[d]imidazole
CAS:Formula:C9H7F3N2OColor and Shape:SolidMolecular weight:216.1599
