CymitQuimica logo

CAS 114166-44-8

:

Ethanethioamide,2-(dimethylamino)-, hydrochloride (1:?)

Description:
Ethanethioamide, 2-(dimethylamino)-, hydrochloride, with the CAS number 114166-44-8, is a chemical compound characterized by its amide functional group and the presence of a dimethylamino substituent. This compound typically appears as a white to off-white solid and is soluble in water due to the hydrochloride form, which enhances its solubility compared to the free base. The presence of the dimethylamino group suggests that it may exhibit basic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Its structure indicates potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as amides often play a crucial role in drug design. Additionally, the hydrochloride salt form is commonly used to improve stability and bioavailability. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C4H10N2SxClH
InChI:InChI=1S/C4H10N2S.ClH/c1-6(2)3-4(5)7;/h3H2,1-2H3,(H2,5,7);1H
InChI key:OQANDCSWKZVVQI-UHFFFAOYSA-N
SMILES:CN(C)CC(=S)N.Cl
Synonyms:
  • Ethanethioamide,2-(dimethylamino)-, hydrochloride (9CI)
Found 3 products.