CymitQuimica logo

CAS 1141886-36-3

:

5-fluoro-6-hydroxypyridin-3-ylboronic acid

Description:
5-Fluoro-6-hydroxypyridin-3-ylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various chemical reactions, particularly in Suzuki coupling reactions. The compound features a pyridine ring substituted with a fluorine atom and a hydroxyl group, contributing to its unique reactivity and potential biological activity. The presence of the boronic acid moiety allows for interactions with biological targets, making it of interest in medicinal chemistry, especially in the development of pharmaceuticals. Its solubility in polar solvents and stability under standard laboratory conditions are typical for boronic acids, although care must be taken to avoid moisture, which can lead to hydrolysis. Overall, 5-fluoro-6-hydroxypyridin-3-ylboronic acid is a versatile compound with applications in organic synthesis and potential therapeutic uses.
Formula:C5H5BFNO3
InChI:InChI=1S/C5H5BFNO3/c7-4-1-3(6(10)11)2-8-5(4)9/h1-2,10-11H,(H,8,9)
InChI key:RNRSXDBJJSBHFY-UHFFFAOYSA-N
SMILES:c1c(cnc(c1F)O)B(O)O
Synonyms:
  • (5-Fluoro-6-oxo-1,6-dihydro-3-pyridinyl)boronic acid
Found 4 products.