CAS 1142-39-8
:4-(Hexyloxy)benzoic acid
Description:
4-(Hexyloxy)benzoic acid, with the CAS number 1142-39-8, is an organic compound characterized by a benzoic acid structure substituted with a hexyloxy group at the para position. This compound typically appears as a white to off-white solid and is soluble in organic solvents, while exhibiting limited solubility in water due to its hydrophobic hexyloxy chain. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Its molecular structure contributes to its potential applications in materials science, particularly in the development of liquid crystals and as a surfactant. Additionally, the hexyloxy group enhances the compound's hydrophobic characteristics, making it useful in formulations requiring improved solubility in non-polar environments. Overall, 4-(Hexyloxy)benzoic acid is a versatile compound with significant implications in both industrial and research settings.
Formula:C13H18O3
InChI:InChI=1S/C13H18O3/c1-2-3-4-5-10-16-12-8-6-11(7-9-12)13(14)15/h6-9H,2-5,10H2,1H3,(H,14,15)
InChI key:InChIKey=HBQUXMZZODHFMJ-UHFFFAOYSA-N
SMILES:O(CCCCCC)C1=CC=C(C(O)=O)C=C1
Synonyms:- 4-(Hexyloxy)Benzoate
- 4-(Hexyloxy)benzoic acid
- 4-Hexoxybenzoic acid
- 4-Hexyloxybenzoic acid
- Benzoic acid, 4-(hexyloxy)-
- Benzoic acid, p-(hexyloxy)-
- Benzoic acid, p-(hexyloxy)- (8CI)
- Nsc 28663
- p-(Hexyloxy)benzoic acid
- p-(n-Hexoxy)benzoic acid
- p-(n-Hexyl-1-oxy)benzoic acid
- p-Hexoylbenzoic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Hexyloxy)benzoic Acid
CAS:Formula:C13H18O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:222.28Benzoic acid, 4-(hexyloxy)-
CAS:Formula:C13H18O3Purity:95%Color and Shape:SolidMolecular weight:222.28024-Hexyloxybenzoic acid
CAS:4-Hexyloxybenzoic acid (4HB) is a white crystalline solid with a melting point of 137.8 °C. It has a molecular weight of 212.2 g/mol and a solubility in water of 0.1g/L at 25 °C. 4HB is not soluble in acetone, ether, or hexane and only slightly soluble in ethanol. The optical properties are: an extinction coefficient ε = 24700 M−1 cm−1, λmax = 318 nm, and λmax = 681 nm. 4HB is optically active with the dipole moment μ = 0.7 D and has an asymmetric hydrogen bond between the alkylthio group and hydroxy group, which gives it chemical stability against heat and light.Formula:C13H18O3Purity:Min. 95%Color and Shape:PowderMolecular weight:222.28 g/mol





