CymitQuimica logo

CAS 114212-23-6

:

2-(2-bromo-4-methylphenoxy)-tetrahydro-2H-pyran

Description:
2-(2-Bromo-4-methylphenoxy)-tetrahydro-2H-pyran is an organic compound characterized by its unique molecular structure, which includes a tetrahydropyran ring and a brominated phenoxy group. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methyl group on the phenyl ring can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. This compound may exhibit moderate to high lipophilicity due to its hydrophobic tetrahydropyran and phenyl components, which can impact its solubility in organic solvents. Additionally, the compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals. Its specific properties, such as boiling point, melting point, and spectral characteristics, would typically be determined through experimental methods and may vary based on purity and environmental conditions.
Formula:C12H15BrO2
InChI:InChI=1S/C12H15BrO2/c1-9-5-6-11(10(13)8-9)15-12-4-2-3-7-14-12/h5-6,8,12H,2-4,7H2,1H3
InChI key:RMPVKDAXBCLEHT-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)OC2CCCCO2)Br
Found 1 products.