CymitQuimica logo

CAS 114214-49-2

:

3-Boc-6-oxa-3-aza-bicyclo[3.1.0]hexane

Description:
3-Boc-6-oxa-3-aza-bicyclo[3.1.0]hexane is a bicyclic compound characterized by its unique structural features, including a bicyclo[3.1.0] framework that incorporates both nitrogen and oxygen heteroatoms. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group in organic synthesis, particularly for amines, indicating that this compound may be used in the synthesis of more complex molecules. The presence of the 6-oxa and 3-aza substituents suggests that the compound has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to mimic natural products or influence biological activity. Its bicyclic structure may contribute to specific conformational properties, which can affect its reactivity and interaction with biological targets. Additionally, the compound's stability, solubility, and reactivity can be influenced by the functional groups present, making it a subject of interest in synthetic organic chemistry and drug design. Overall, 3-Boc-6-oxa-3-aza-bicyclo[3.1.0]hexane represents a versatile scaffold for further chemical modifications and applications.
Formula:C9H15NO3
InChI:InChI=1/C9H15NO3/c1-9(2,3)13-8(11)10-4-6-7(5-10)12-6/h6-7H,4-5H2,1-3H3
InChI key:NXZIGGBPLGAPTI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC2C(C1)O2
Synonyms:
  • 6-Oxa-3-azabicyclo[3.1.0]hexane-3-carboxylic acid, 1,1-dimethylethyl ester
  • tert-Butyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate
  • (1R,5S)-tert-butyl 6-oxa-3-azabicyclo[3.1.0]hexane-3-carboxylate
  • 6-Oxa-3-Azabicyclo[3.1.0]Hexane-3-Carboxylic Acid Tert-Butyl Ester
Found 5 products.