CymitQuimica logo

CAS 1142191-71-6

:

2-Chloro-4-iodo-3-pyridinecarboxaldehyde oxime

Description:
2-Chloro-4-iodo-3-pyridinecarboxaldehyde oxime is a chemical compound characterized by its unique functional groups and structural features. It contains a pyridine ring, which is a six-membered aromatic heterocycle with one nitrogen atom, contributing to its basicity and reactivity. The presence of both a chloro and an iodo substituent on the pyridine ring enhances its electrophilic properties, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The oxime functional group, derived from the reaction of an aldehyde with hydroxylamine, imparts additional reactivity, particularly in forming derivatives through condensation reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemicals. Its solubility and stability can vary depending on the solvent and environmental conditions, influencing its applications in research and industry. Overall, 2-Chloro-4-iodo-3-pyridinecarboxaldehyde oxime is a versatile compound with potential uses in synthetic organic chemistry and pharmacology.
Formula:C6H4ClIN2O
InChI:InChI=1S/C6H4ClIN2O/c7-6-4(3-10-11)5(8)1-2-9-6/h1-3,11H
InChI key:InChIKey=ABKINKACNRUTLY-UHFFFAOYSA-N
SMILES:C(=NO)C=1C(I)=CC=NC1Cl
Synonyms:
  • 3-Pyridinecarboxaldehyde, 2-chloro-4-iodo-, oxime
  • 2-Chloro-4-iodo-3-pyridinecarboxaldehyde oxime
Found 2 products.