CymitQuimica logo

CAS 1142192-58-2

:

4,5-Dichloro-1H-pyrrolo[2,3-b]pyridine

Description:
4,5-Dichloro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of two chlorine atoms at the 4 and 5 positions of the pyrrole ring enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. It may also serve as an intermediate in the synthesis of other complex organic molecules. The compound's structure allows for various substitution reactions, making it versatile in synthetic organic chemistry. Additionally, its stability under standard laboratory conditions makes it suitable for further chemical modifications. Safety data should be consulted, as halogenated compounds can pose environmental and health risks. Overall, 4,5-Dichloro-1H-pyrrolo[2,3-b]pyridine is a significant compound in research and development within the field of organic chemistry.
Formula:C7H4Cl2N2
InChI:InChI=1S/C7H4Cl2N2/c8-5-3-11-7-4(6(5)9)1-2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=JCLZDOZRYOFSNV-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1Cl)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4,5-dichloro-
  • 4,5-Dichloro-1H-pyrrolo[2,3-b]pyridine
  • 5-Chloro-4-chloro-1H-pyrrolo[2,3-b]pyridine
Found 4 products.