CymitQuimica logo

CAS 1142194-24-8

:

4-Bromo-2-(1-methylethoxy)pyridine

Description:
4-Bromo-2-(1-methylethoxy)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 4-position and a 1-methylethoxy group at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it useful in various chemical reactions and applications, particularly in organic synthesis and medicinal chemistry. The bromine substituent can participate in nucleophilic substitution reactions, while the methylethoxy group can influence the compound's reactivity and solubility. Additionally, the presence of the nitrogen atom in the pyridine ring can impart basicity, allowing it to act as a ligand in coordination chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4-Bromo-2-(1-methylethoxy)pyridine is a versatile compound with potential applications in pharmaceuticals and agrochemicals.
Formula:C8H10BrNO
InChI:InChI=1S/C8H10BrNO/c1-6(2)11-8-5-7(9)3-4-10-8/h3-6H,1-2H3
InChI key:InChIKey=DGDIOQCZNZMIPA-UHFFFAOYSA-N
SMILES:O(C(C)C)C1=CC(Br)=CC=N1
Synonyms:
  • 4-Bromo-2-isopropoxypyridine
  • Pyridine, 4-bromo-2-(1-methylethoxy)-
  • 4-Bromo-2-(1-methylethoxy)pyridine
Found 4 products.