CymitQuimica logo

CAS 1142195-02-5

:

4-Bromo-2-(2-pyridinyl)pyrimidine

Description:
4-Bromo-2-(2-pyridinyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 4-position and a pyridine ring at the 2-position contributes to its unique chemical properties. This compound is typically used in medicinal chemistry and research due to its potential biological activity, particularly in the development of pharmaceuticals. It may exhibit properties such as antimicrobial, anti-inflammatory, or anticancer activities, depending on its interactions with biological targets. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its solubility and stability can vary based on the solvent and conditions used, which is important for its application in laboratory settings. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C9H6BrN3
InChI:InChI=1S/C9H6BrN3/c10-8-4-6-12-9(13-8)7-3-1-2-5-11-7/h1-6H
InChI key:InChIKey=WQINVZKQEPMVLU-UHFFFAOYSA-N
SMILES:BrC1=NC(=NC=C1)C2=CC=CC=N2
Synonyms:
  • Pyrimidine, 4-bromo-2-(2-pyridinyl)-
  • 4-Bromo-2-(2-pyridinyl)pyrimidine
Found 2 products.