CymitQuimica logo

CAS 1142202-56-9

:

Hexahydro-α-oxo-1(2H)-azocineacetic acid

Description:
Hexahydro-α-oxo-1(2H)-azocineacetic acid, identified by its CAS number 1142202-56-9, is a chemical compound that features a unique bicyclic structure. This substance belongs to the class of azocine derivatives, characterized by a nitrogen-containing heterocyclic ring system. The presence of a carboxylic acid functional group contributes to its acidic properties, while the hexahydro structure indicates that it is fully saturated, which affects its reactivity and stability. The α-oxo group suggests that it may exhibit ketone-like behavior, potentially participating in various chemical reactions such as nucleophilic additions. This compound may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific applications may vary based on its reactivity and biological activity. Its solubility, melting point, and other physical properties would depend on the molecular interactions and the presence of functional groups. Overall, Hexahydro-α-oxo-1(2H)-azocineacetic acid represents a complex structure with potential utility in various chemical contexts.
Formula:C9H15NO3
InChI:InChI=1S/C9H15NO3/c11-8(9(12)13)10-6-4-2-1-3-5-7-10/h1-7H2,(H,12,13)
InChI key:InChIKey=GOSNZTMEKBYIQT-UHFFFAOYSA-N
SMILES:C(C(O)=O)(=O)N1CCCCCCC1
Synonyms:
  • Hexahydro-α-oxo-1(2H)-azocineacetic acid
  • 1(2H)-Azocineacetic acid, hexahydro-α-oxo-
Found 1 products.