CymitQuimica logo

CAS 1142211-17-3

:

tert-Butyl [1-(hydroxymethyl)cyclobutyl]carbamate

Description:
Tert-Butyl [1-(hydroxymethyl)cyclobutyl]carbamate is an organic compound characterized by its carbamate functional group, which is derived from the reaction of a carbamic acid with an alcohol. This compound features a tert-butyl group, providing steric hindrance and influencing its solubility and reactivity. The presence of the hydroxymethyl group attached to a cyclobutane ring contributes to its structural complexity and potential for hydrogen bonding, which can affect its physical properties such as boiling point and solubility in various solvents. The cyclobutane ring adds rigidity to the molecular structure, which may impact its conformational behavior and interactions with other molecules. Tert-Butyl [1-(hydroxymethyl)cyclobutyl]carbamate may have applications in medicinal chemistry or as an intermediate in organic synthesis, although specific applications would depend on its reactivity and the context of its use. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C10H19NO3
InChI:InChI=1S/C10H19NO3/c1-9(2,3)14-8(13)11-10(7-12)5-4-6-10/h12H,4-7H2,1-3H3,(H,11,13)
InChI key:CLRGYDRXIYIAHC-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=NC1(CCC1)CO)O
Synonyms:
  • 2-Methyl-2-propanyl [1-(hydroxymethyl)cyclobutyl]carbamate
  • N-Boc-1-amino-cyclobutyl-methanol
Found 4 products.