CymitQuimica logo

CAS 114224-27-0

:

1H-Indol-3-ol, 6-bromo-

Description:
1H-Indol-3-ol, 6-bromo- is a chemical compound characterized by the presence of a bromine atom at the 6-position of the indole ring, which is a bicyclic structure composed of a benzene ring fused to a pyrrole ring. This compound features a hydroxyl (-OH) group at the 3-position, contributing to its classification as an indol-3-ol derivative. The presence of the bromine atom introduces unique reactivity and potential biological activity, making it of interest in medicinal chemistry and organic synthesis. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for various interactions, including hydrogen bonding due to the hydroxyl group, which can influence its chemical behavior and potential applications. Additionally, the compound may exhibit fluorescence properties, making it useful in certain analytical techniques. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns.
Formula:C8H6BrNO
InChI:InChI=1S/C8H6BrNO/c9-5-1-2-6-7(3-5)10-4-8(6)11/h1-4,10-11H
InChI key:QWWXZNUEYOUPMC-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1Br)NC=C2O
Synonyms:
  • 1-Boc-6-bromo-1H-indol-3-ol
  • 1H-Indol-3-ol, 6-broMo-
  • 6-BROMO-1H-INDOL-3-OL
Found 2 products.