CymitQuimica logo

CAS 114224-28-1

:

7-Bromo-1H-indol-3-ol

Description:
7-Bromo-1H-indol-3-ol is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a bromine atom at the 7-position and a hydroxyl group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the hydroxyl group, while its aromatic nature allows for interactions with various biological systems. 7-Bromo-1H-indol-3-ol is of interest in medicinal chemistry and research due to its potential biological activities, including antimicrobial and anticancer properties. Its reactivity can be influenced by the bromine substituent, which may participate in electrophilic substitution reactions. Additionally, the compound's ability to form hydrogen bonds due to the hydroxyl group can affect its interactions with other molecules, making it a valuable subject for studies in drug design and development. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C8H6BrNO
InChI:InChI=1S/C8H6BrNO/c9-6-3-1-2-5-7(11)4-10-8(5)6/h1-4,10-11H
InChI key:InChIKey=CQEPLPMQDMJGCH-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(O)=CN2)=CC=C1
Synonyms:
  • 1H-Indol-3-ol, 7-broMo-
  • 7-Bromo-1H-indol-3-ol
  • Indoxyl, 7-bromo-
Found 1 products.