CAS 114253-85-9

4-hydroxy-4-methyl-2-pentanone-D12

Description:

4-Hydroxy-4-methyl-2-pentanone-D12, with the CAS number 114253-85-9, is a deuterated derivative of 4-hydroxy-4-methyl-2-pentanone, which is a ketone compound. This substance features a hydroxyl group (-OH) and a methyl group attached to a pentanone backbone, contributing to its unique chemical properties. The presence of deuterium (D) in the molecular structure indicates that some hydrogen atoms have been replaced with deuterium isotopes, which can affect the compound's physical and chemical behavior, including its stability and reactivity. Typically, deuterated compounds are used in various applications, including NMR spectroscopy, where they serve as solvents or tracers due to their distinct spectral signatures. The compound is likely to be a colorless liquid at room temperature, with a characteristic odor, and it may exhibit moderate solubility in polar solvents. Safety data sheets should be consulted for handling and storage guidelines, as with any chemical substance.

Formula: C6H12O2

InChI: InChI=1S/C6H12O2/c1-5(7)4-6(2,3)8/h8H,4H2,1-3H3/i1D3,2D3,3D3,4D2,8D

InChI key: SWXVUIWOUIDPGS-YDUIPVTMSA-N

SMILES: [2H]C([2H])([2H])C(=O)C([2H])([2H])C(C([2H])([2H])[2H])(C([2H])([2H])[2H])O[2H]

4-Hydroxy-4-methyl-2-pentanone-d12

CAS: 114253-85-9, 123-42-2

Formula: (CD₃)₂C(OD)CD₂COCD₃

Purity: 99 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 128.15905

Ref: 3U-D6323

4-Hydroxy-4-methyl-2-pentanone-d12

Controlled Product

CAS: 114253-85-9

Applications 4-Hydroxy-4-methyl-2-pentanone-d12 (CAS# 114253-85-9) is a useful isotopically labeled research compound.

Formula: C₆D₁₂O₂

Color and Shape: Neat

Molecular weight: 128.232

Ref: TR-D679901