CymitQuimica logo

CAS 114326-10-2

:

Ethanethioic acid, S-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl] ester (9CI)

Description:
Ethanethioic acid, S-[2-[[(1,1-dimethylethoxy)carbonyl]amino]ethyl] ester, also known by its CAS number 114326-10-2, is a chemical compound characterized by its ester functional group and a thioic acid moiety. This compound features a thioester linkage, which is formed by the reaction of ethanethioic acid with an alcohol, in this case, a derivative of 1,1-dimethylethanol. The presence of the amino group suggests potential for reactivity and interaction with various biological systems, making it of interest in medicinal chemistry and synthetic applications. Its structure indicates that it may exhibit properties typical of both esters and thioacids, such as volatility and solubility in organic solvents. Additionally, the bulky dimethylethoxycarbonyl group may influence its steric and electronic properties, potentially affecting its reactivity and stability. Overall, this compound's unique structure positions it as a valuable intermediate in organic synthesis and possibly in pharmaceutical development.
Formula:C9H17NO3S
InChI:InChI=1S/C9H17NO3S/c1-7(11)14-6-5-10-8(12)13-9(2,3)4/h5-6H2,1-4H3,(H,10,12)
InChI key:SYLBKLDSMWKIJJ-UHFFFAOYSA-N
SMILES:CC(=O)SCCNC(=O)OC(C)(C)C
Found 4 products.