CAS 114335-54-5

2-Amino-4-bromo-3-pyridinol

Description:

2-Amino-4-bromo-3-pyridinol is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of an amino group (-NH2) and a bromo substituent (-Br) on the pyridine ring significantly influences its chemical properties and reactivity. This compound typically exhibits moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is often used in pharmaceutical research and development, particularly as a building block in the synthesis of various biologically active molecules. The bromine atom introduces electrophilic characteristics, making it a potential site for further chemical modifications. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry contexts. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks. Overall, 2-Amino-4-bromo-3-pyridinol is a versatile compound with applications in organic synthesis and medicinal chemistry.

Formula: C₅H₅BrN₂O

InChI: InChI=1S/C5H5BrN2O/c6-3-1-2-8-5(7)4(3)9/h1-2,9H,(H2,7,8)

InChI key: VHVGFRZWGORWHX-UHFFFAOYSA-N

SMILES: c1c[nH]c(=N)c(c1Br)O

2-Amino-4-bromopyridin-3-ol

CAS: 114335-54-5

2-Amino-4-bromopyridin-3-ol

Formula: C₅H₅BrN₂O

Purity: 98%

Molecular weight: 189.01

Ref: 54-OR1033985

2-Amino-4-bromopyridin-3-ol

CAS: 114335-54-5

Formula: C₅H₅BrN₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 189.0100

Ref: IN-DA000B4B

2-Amino-4-bromopyridin-3-ol

CAS: 114335-54-5

2-Amino-4-bromopyridin-3-ol

Formula: C₅H₅BrN₂O

Purity: 95%

Molecular weight: 189.01

Ref: IN-DG208796

2-Amino-4-bromopyridin-3-ol

CAS: 114335-54-5

Purity: 98%

Molecular weight: 189.0119934

Ref: 10-F621700

2-Amino-4-bromopyridin-3-ol

CAS: 114335-54-5

2-Amino-4-bromopyridin-3-ol is an organometallic compound that is synthesized from benzyl alcohol and 2-chloro-5 nitrobenzaldehyde. It has a molecular weight of 263.2 g/mol and a melting point of 171 degrees Celsius. The compound has been observed as a white crystalline powder with a melting point range of 119 to 173 degrees Celsius. The compound exhibits electron microscopy morphology, which is spherical in shape with a size range of 1 to 10 nm. 2-Amino-4 bromopyridin-3-ol has been shown to be selective for the benzyl alcohol substrate, yielding high yields of up to 98%.

Formula: C₅H₅BrN₂O

Purity: Min. 95%

Molecular weight: 189.01 g/mol

Ref: 3D-PEA33554