CymitQuimica logo

CAS 114340-53-3

:

2-(1,1-Dimethylethyl) 1,3-bis(2,5-dioxo-1-pyrrolidinyl) 2-hydroxy-1,2,3-propanetricarboxylate

Description:
2-(1,1-Dimethylethyl) 1,3-bis(2,5-dioxo-1-pyrrolidinyl) 2-hydroxy-1,2,3-propanetricarboxylate, with CAS number 114340-53-3, is a chemical compound characterized by its complex structure, which includes multiple functional groups such as carboxylates and pyrrolidinyl moieties. This compound is likely to exhibit properties typical of derivatives of citric acid due to the presence of the tricarboxylate structure, which may contribute to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the dimethyl group suggests steric hindrance, which could influence its reactivity and solubility. Additionally, the pyrrolidinyl groups may impart specific biological activities or enhance interactions with biological targets. The compound's stability, solubility, and reactivity would depend on the specific conditions, such as pH and temperature, as well as the presence of other reactants. Overall, this compound's unique structure suggests potential utility in synthetic chemistry and possibly in medicinal chemistry, although specific applications would require further investigation.
Formula:C18H22N2O11
InChI:InChI=1S/C18H22N2O11/c1-17(2,3)29-16(27)18(28,8-14(25)30-19-10(21)4-5-11(19)22)9-15(26)31-20-12(23)6-7-13(20)24/h28H,4-9H2,1-3H3
InChI key:InChIKey=OLFFOQNGXMMYBM-UHFFFAOYSA-N
SMILES:C(CC(ON1C(=O)CCC1=O)=O)(CC(ON2C(=O)CCC2=O)=O)(C(OC(C)(C)C)=O)O
Synonyms:
  • 2-(1,1-Dimethylethyl) 1,3-bis(2,5-dioxo-1-pyrrolidinyl) 2-hydroxy-1,2,3-propanetricarboxylate
  • 2-(tert-Butyl) 1,3-bis(succinimidyl) citrate
  • Citric acid 2-(tert-butyl) 1,3-bis(succinimidyl) ester
  • Butanoic acid, 4-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-[2-[(2,5-dioxo-1-pyrrolidinyl)oxy]-2-oxoethyl]-2-hydroxy-4-oxo-, 1,1-dimethylethyl ester
  • 1,2,3-Propanetricarboxylic acid, 2-hydroxy-, 2-(1,1-dimethylethyl) 1,3-bis(2,5-dioxo-1-pyrrolidinyl) ester
Found 1 products.