CymitQuimica logo

CAS 114344-00-2

:

3-formyl-2-nitrobenzonitrile

Description:
3-Formyl-2-nitrobenzonitrile is an organic compound characterized by its functional groups, which include an aldehyde (formyl group), a nitro group, and a nitrile group. The presence of these groups contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a crystalline solid and is soluble in organic solvents. Its molecular structure features a benzene ring substituted at the 2 and 3 positions, which influences its electronic properties and reactivity. The nitro group is known for its electron-withdrawing effects, which can enhance the electrophilicity of the carbonyl carbon in the formyl group, making it a useful intermediate in various chemical reactions, including nucleophilic additions. Additionally, the nitrile group can participate in further transformations, allowing for the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks due to its reactive nature and potential toxicity. Overall, 3-formyl-2-nitrobenzonitrile serves as a valuable building block in the field of organic chemistry.
Formula:C8H4N2O3
InChI:InChI=1S/C8H4N2O3/c9-4-6-2-1-3-7(5-11)8(6)10(12)13/h1-3,5H
InChI key:HUGYRUWVKNAJOH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C(=C1)C#N)[N+](=O)[O-])C=O
Synonyms:
  • 3-formyl-2-nitrobenzonitrile
Found 1 products.