CAS 114360-54-2
:fmoc-D-leucine
Description:
Fmoc-D-leucine, with the CAS number 114360-54-2, is a derivative of the amino acid leucine, modified with a fluorenylmethyloxycarbonyl (Fmoc) protecting group. This compound is characterized by its white to off-white crystalline appearance and is commonly used in peptide synthesis as a protective group for the amino group of the amino acid. The Fmoc group is stable under basic conditions but can be removed under acidic conditions, allowing for selective deprotection during the synthesis of peptides. Fmoc-D-leucine is particularly notable for its role in the synthesis of peptides that require the incorporation of D-amino acids, which can influence the biological activity and stability of the resulting peptides. Its solubility is generally good in organic solvents, making it suitable for various synthetic applications. Additionally, the presence of the D-isomer can impart unique properties to peptides, such as resistance to enzymatic degradation, which is valuable in pharmaceutical development.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-13(2)11-19(20(23)24)22-21(25)26-12-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,13,18-19H,11-12H2,1-2H3,(H,22,25)(H,23,24)/t19-/m1/s1
SMILES:CC(C)C[C@H](C(=O)O)N=C(O)OCC1c2ccccc2c2ccccc12
Synonyms:- Fmoc-D-Leu-OH
- NALPHA-9-Fluorenylmethoxycarbonyl-D-leucine
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]leucine
- N-[(9H-fluoren-9-ylmethoxy)carbonyl]-D-leucine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-leucine
CAS:Formula:C21H23NO4Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:353.42N-Fmoc-D-leucine, 98%
CAS:<p>A convergent synthesis of the proposed structure of (+)-pestalazine B has been achieved in 4 steps using the N-alkylation of an unprotected tryptophan diketopiperazine with a 3a-bromopyrrolidinoindoline where the condensation between L-tryptophan methyl ester and N-Fmoc-D-leucine in the presence of </p>Formula:C21H23NO4Purity:98%Color and Shape:Powder, White to pale creamMolecular weight:353.42Fmoc-D-Leu-OH
CAS:<p>Bachem ID: 4005951.</p>Formula:C21H23NO4Purity:99.8%Color and Shape:WhiteMolecular weight:353.42D-Leucine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-
CAS:Formula:C21H23NO4Purity:98%Color and Shape:SolidMolecular weight:353.4116Fmoc-D-Leu-OH
CAS:Formula:C21H23NO4Purity:≥ 99.0%Color and Shape:White to almost white powder or crystalsMolecular weight:353.42Fmoc-D-Leu-OH
CAS:<p>Fmoc-D-Leu-OH is a disulfide bond containing molecule with an intracellular Ca2+ chelating activity. It has been shown to have cytoprotective effects against oxidative stress and cell death, and has also been found to have antiinflammatory properties. Fmoc-D-Leu-OH can inhibit the activities of various enzymes such as cyclooxygenase, lipoxygenase, phospholipases, and diamine oxidase. This molecule also exhibits cytotoxic activity against bladder cancer cells in vitro. The pharmacokinetic properties of Fmoc-D-Leu-OH are similar to other molecules that are used as antibiotics.<br>Fmoc-D-Leu-OH is a cyclic peptide with antimicrobial peptide (AMP) activity that inhibits bacterial growth by disrupting their cell membranes or inhibiting protein synthesis. It binds to bacterial 16S ribosomal RNA and inhibits protein synthesis, leading</p>Formula:C21H23NO4Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:353.41 g/molFmoc-D-Leu-OH
CAS:<p>M03366 - Fmoc-D-Leu-OH</p>Formula:C21H23NO4Purity:97%Color and Shape:Solid, Crystalline Powder or PowderMolecular weight:353.418FMOC-D-Leucine extrapure, 99%
CAS:Formula:C21H23NO4Purity:min. 99.0%Color and Shape:White, Crystalline powderMolecular weight:353.40
![N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-D-leucine](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2F3B%2Fthumb%2FF0603.jpg&w=3840&q=75)
![D-Leucine, N-[(9H-fluoren-9-ylmethoxy)carbonyl]-](/_next/image/?url=https%3A%2Fstatic.cymitquimica.com%2Fproducts%2FIN%2Fthumb%2FDA000B5W.jpg&w=3840&q=75)
