CymitQuimica logo

CAS 114362-19-5

:

4-Pyrimidinamine, 2-(1-methylethyl)- (9CI)

Description:
4-Pyrimidinamine, 2-(1-methylethyl)-, also known by its CAS number 114362-19-5, is an organic compound characterized by a pyrimidine ring substituted with an amino group and an isopropyl group. This compound features a six-membered aromatic heterocyclic structure containing nitrogen atoms, which contributes to its basicity and potential reactivity. The presence of the amino group (-NH2) enhances its ability to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The isopropyl group provides steric hindrance, which can influence the compound's reactivity and interactions with other molecules. 4-Pyrimidinamine derivatives are often studied for their biological activities, including potential applications in pharmaceuticals and agrochemicals. The compound's solubility, stability, and reactivity can vary depending on the specific conditions, such as pH and solvent used. Overall, this substance is of interest in both synthetic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C7H11N3
InChI:InChI=1S/C7H11N3/c1-5(2)7-9-4-3-6(8)10-7/h3-5H,1-2H3,(H2,8,9,10)
InChI key:AREOKSGFWPUZLH-UHFFFAOYSA-N
SMILES:CC(C)C1=NC=CC(=N1)N
Found 5 products.