CymitQuimica logo

CAS 1144037-37-5

:

3,5-dichlorobenzyl piperazine-1-carboxylate

Description:
3,5-Dichlorobenzyl piperazine-1-carboxylate is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of the 3,5-dichlorobenzyl group indicates that chlorine atoms are substituted at the 3 and 5 positions of the benzyl moiety, contributing to the compound's unique properties. This compound is typically classified as an organic molecule and may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its carboxylate functional group suggests potential interactions with biological systems, possibly influencing solubility and reactivity. The molecular structure allows for various interactions, including hydrogen bonding and hydrophobic interactions, which can affect its behavior in different environments. As with many piperazine derivatives, it may have applications in drug development, particularly in the context of neuropharmacology or as a scaffold for synthesizing other bioactive compounds. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H14Cl2N2O2
InChI:InChI=1S/C12H14Cl2N2O2/c13-10-5-9(6-11(14)7-10)8-18-12(17)16-3-1-15-2-4-16/h5-7,15H,1-4,8H2
InChI key:RBPSRPYEBWMAGK-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C(=O)OCC2=CC(=CC(=C2)Cl)Cl
Synonyms:
  • 1-Piperazinecarboxylic acid, (3,5-dichlorophenyl)methyl ester
  • 3,5-dichlorobenzyl piperazine-1-carboxylate
Found 3 products.