CymitQuimica logo

CAS 1144068-46-1

:

WYE-125132

Description:
WYE-125132, identified by its CAS number 1144068-46-1, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is classified as a small molecule and is known to act as a selective inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth, differentiation, and metabolism. The compound's structure typically features specific functional groups that contribute to its biological activity and selectivity. In preclinical studies, WYE-125132 has shown promise in inhibiting tumor growth and may be explored for its efficacy in treating certain types of cancer. Its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are essential for determining its suitability for further development as a therapeutic agent. As with many investigational compounds, ongoing research is necessary to fully elucidate its mechanism of action, safety profile, and potential clinical applications.
Formula:C27H33N7O4
InChI:InChI=1S/C27H33N7O4/c1-28-26(35)30-18-4-2-17(3-5-18)23-31-24(33-15-20-6-7-21(16-33)38-20)22-14-29-34(25(22)32-23)19-8-10-27(11-9-19)36-12-13-37-27/h2-5,14,19-21H,6-13,15-16H2,1H3,(H2,28,30,35)
InChI key:QLHHRYZMBGPBJG-UHFFFAOYSA-N
SMILES:CNC(=O)NC1=CC=C(C=C1)C2=NC3=C(C=NN3C4CCC5(CC4)OCCO5)C(=N2)N6CC7CCC(C6)O7
Found 5 products.