CymitQuimica logo

CAS 114413-77-3

:

N-(1,3-benzodioxol-5-ylmethyl)cyclopentanamine

Description:
N-(1,3-benzodioxol-5-ylmethyl)cyclopentanamine, with the CAS number 114413-77-3, is a chemical compound characterized by its unique structure that includes a cyclopentanamine moiety and a benzodioxole group. This compound features a five-membered cyclopentane ring, which contributes to its cyclic nature and potential conformational flexibility. The presence of the benzodioxole group, a fused bicyclic structure, imparts specific electronic and steric properties that can influence its reactivity and interactions with biological systems. Typically, compounds of this nature may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The functional groups present in the molecule can participate in hydrogen bonding and other intermolecular interactions, which are crucial for biological activity. Additionally, the compound's solubility, stability, and potential for forming derivatives are important characteristics that can affect its application in research and industry. Overall, N-(1,3-benzodioxol-5-ylmethyl)cyclopentanamine represents a class of compounds that may have significant implications in drug development and chemical synthesis.
Formula:C13H17NO2
InChI:InChI=1/C13H17NO2/c1-2-4-11(3-1)14-8-10-5-6-12-13(7-10)16-9-15-12/h5-7,11,14H,1-4,8-9H2
InChI key:LOYZMUZNAPZSOX-UHFFFAOYSA-N
SMILES:C1CCC(C1)NCc1ccc2c(c1)OCO2
Synonyms:
  • 1,3-Benzodioxole-5-methanamine, N-cyclopentyl-
  • Benzo[1,3]dioxol-5-ylmethyl-cyclopentyl-amine
  • N-(1,3-benzodioxol-5-ylmethyl)-N-cyclopentylamine
Found 3 products.