CymitQuimica logo

CAS 114413-97-7

:

Pentanamide, 5-(2,5-dimethylphenoxy)-2,2-dimethyl-

Description:
Pentanamide, 5-(2,5-dimethylphenoxy)-2,2-dimethyl- is an organic compound characterized by its amide functional group and a complex aromatic structure. It features a pentanamide backbone, which indicates the presence of a five-carbon chain attached to the amide group. The compound also includes a 2,5-dimethylphenoxy substituent, contributing to its hydrophobic characteristics and potential biological activity. The presence of multiple methyl groups enhances its steric bulk and may influence its solubility and reactivity. This compound is likely to exhibit moderate polarity due to the amide functional group, which can engage in hydrogen bonding. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such compounds may serve as intermediates or active ingredients. Additionally, the specific arrangement of substituents can affect its interaction with biological systems, making it a candidate for further investigation in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C15H23NO2
InChI:InChI=1S/C15H23NO2/c1-11-6-7-12(2)13(10-11)18-9-5-8-15(3,4)14(16)17/h6-7,10H,5,8-9H2,1-4H3,(H2,16,17)
InChI key:YJMCJQKGIPBLRJ-UHFFFAOYSA-N
SMILES:CC1=CC(=C(C=C1)C)OCCCC(C)(C)C(=O)N
Found 4 products.