CymitQuimica logo

CAS 114417-34-4

:

4(1H)-Quinolinone, 7-bromo-2,3-dihydro-

Description:
4(1H)-Quinolinone, 7-bromo-2,3-dihydro- is a chemical compound characterized by its quinolinone structure, which features a fused bicyclic system containing a nitrogen atom. This compound typically exhibits a pale yellow to brownish appearance and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the bromine atom at the 7-position of the quinolinone ring can influence its reactivity and interaction with biological targets, making it of interest in drug development. The dihydro form indicates that it has two hydrogen atoms added to the ring, which can affect its stability and solubility. This compound may be utilized in various applications, including as a precursor in organic synthesis or as a potential pharmacophore in the development of therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 4(1H)-Quinolinone, 7-bromo-2,3-dihydro- represents a significant structure in the field of organic and medicinal chemistry.
Formula:C9H8BrNO
InChI:InChI=1S/C9H8BrNO/c10-6-1-2-7-8(5-6)11-4-3-9(7)12/h1-2,5,11H,3-4H2
InChI key:MZRDGUADMZHLRW-UHFFFAOYSA-N
SMILES:C1CNC2=C(C1=O)C=CC(=C2)Br
Synonyms:
  • 7-Bromo-2,3-Dihydroquinolin-4(1H)-One
Found 5 products.