CymitQuimica logo

CAS 114432-00-7

:

Quinoline, 8-chloro-5,6,7,8-tetrahydro-, hydrochloride (1:1)

Description:
Quinoline, 8-chloro-5,6,7,8-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its bicyclic structure, which includes a quinoline moiety and a tetrahydro derivative. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form. The compound features a chlorine atom at the 8-position of the quinoline ring, which can influence its reactivity and biological activity. Quinoline derivatives are known for their diverse pharmacological properties, including antimicrobial and antimalarial activities. The hydrochloride form enhances its stability and solubility, making it suitable for various applications in medicinal chemistry. As with many nitrogen-containing heterocycles, it may exhibit basic properties due to the nitrogen atoms in the ring structure. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry contexts.
Formula:C9H10ClN·ClH
InChI:InChI=1S/C9H10ClN.ClH/c10-8-5-1-3-7-4-2-6-11-9(7)8;/h2,4,6,8H,1,3,5H2;1H
InChI key:InChIKey=CIIMLMHZIAAHJB-UHFFFAOYSA-N
SMILES:ClC1C=2C(CCC1)=CC=CN2.Cl
Synonyms:
  • Quinoline, 8-chloro-5,6,7,8-tetrahydro-, hydrochloride
  • Quinoline, 8-chloro-5,6,7,8-tetrahydro-, hydrochloride (1:1)
Found 1 products.