CAS 114446-55-8
:(S)-(-)-2-bromo-alpha-methylbenzyl alcohol
Description:
(S)-(-)-2-bromo-alpha-methylbenzyl alcohol, with the CAS number 114446-55-8, is a chiral organic compound characterized by its bromine substituent and alcohol functional group. This compound features a bromine atom attached to the second carbon of a benzyl alcohol structure, which is further substituted with a methyl group at the alpha position relative to the alcohol. The presence of the bromine atom contributes to its reactivity, making it useful in various synthetic applications, particularly in organic synthesis and medicinal chemistry. The chiral nature of this compound allows for potential applications in asymmetric synthesis, where the specific enantiomer can influence the biological activity of the resulting products. Additionally, the compound's solubility properties are influenced by the alcohol group, which can engage in hydrogen bonding, affecting its interactions in different solvents. Overall, (S)-(-)-2-bromo-alpha-methylbenzyl alcohol is significant in the context of stereochemistry and synthetic organic chemistry.
Formula:C8H9BrO
InChI:InChI=1/C8H9BrO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m0/s1
InChI key:DZLZSFZSPIUINR-LURJTMIESA-N
SMILES:C[C@@H](c1ccccc1Br)O
Synonyms:- (1S)-1-(2-bromophenyl)ethanol
- (S)-1-(2-Bromophenyl)Ethanol
- (S)-(?-2-Bromo-alpha-methylbenzyl alcohol
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(S)-1-(2-Bromophenyl)ethan-1-ol
CAS:Formula:C8H9BrOPurity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:201.06(S)-1-(2-Bromophenyl)ethanol
CAS:Formula:C8H9BrOPurity:98%Color and Shape:SolidMolecular weight:201.0605(S)-1-(2-Bromophenyl)ethanol
CAS:(S)-1-(2-Bromophenyl)ethanolFormula:C8H9BrOPurity:98%Color and Shape:SolidMolecular weight:201.06(S)-1-(2-Bromophenyl)ethanol
CAS:(S)-1-(2-Bromophenyl)ethanolFormula:C8H9BrOPurity:98%Molecular weight:201.06(S)-(-)-2-Bromo-alpha-methylbenzyl alcohol
CAS:2-Bromo-alpha-methylbenzyl alcohol is a chiral molecule that has two enantiomers, which are mirror images of each other. The (S)-(+)-enantiomer is the active form and the (R)-(-)-enantiomer has no biological activity. 2-Bromo-alpha-methylbenzyl alcohol can be hydrogenated to form (+) -2-bromo-alpha-methylbenzaldehyde, which is an allylic compound with a conjugate diastereomeric relationship to it. This means that the two enantiomers have different chemical properties because they are structurally related in a way that does not allow for rotation about a single bond. The (S)-(+)-enantiomer of 2-bromo-alpha-methylbenzyl alcohol exhibits high affinity for phosphorus ligands, while the (R)-(-)-enantiomer has no affinity.Formula:C8H9BrOPurity:Min. 95%Molecular weight:201.06 g/mol





