CymitQuimica logo

CAS 114458-03-6

:

1,3-Dioxolane-4-acetic acid,2,2-dimethyl-5-oxo-

Description:
1,3-Dioxolane-4-acetic acid, 2,2-dimethyl-5-oxo- is a chemical compound characterized by its unique dioxolane ring structure, which contributes to its reactivity and stability. This compound features a five-membered cyclic ether with two oxygen atoms and a carboxylic acid functional group, which enhances its solubility in polar solvents. The presence of the dimethyl and keto groups introduces steric hindrance and influences its chemical behavior, potentially affecting its reactivity in various organic reactions. It is typically used in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block or intermediate. The compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 1,3-Dioxolane-4-acetic acid, 2,2-dimethyl-5-oxo- is a versatile compound with applications in various chemical syntheses.
Formula:C7H10O5
InChI:InChI=1S/C7H10O5/c1-7(2)11-4(3-5(8)9)6(10)12-7/h4H,3H2,1-2H3,(H,8,9)
InChI key:IDQOCLIWDMZKBZ-UHFFFAOYSA-N
SMILES:CC1(OC(C(=O)O1)CC(=O)O)C
Found 3 products.