CymitQuimica logo

CAS 114468-01-8

:

Pyridine, 2-(difluoromethyl)- (9CI)

Description:
Pyridine, 2-(difluoromethyl)-, also known by its CAS number 114468-01-8, is a heterocyclic organic compound characterized by a six-membered aromatic ring containing one nitrogen atom. This compound features a difluoromethyl group (-CF2H) attached to the second carbon of the pyridine ring, which influences its chemical reactivity and properties. Pyridine derivatives are known for their polar nature, which can enhance solubility in polar solvents. The presence of the difluoromethyl group can impart unique characteristics, such as increased lipophilicity and potential biological activity. Pyridine itself is a weak base and can participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The difluoromethyl substituent may also affect the compound's stability and reactivity, making it of interest in medicinal chemistry and materials science. Overall, this compound's unique structure and substituents contribute to its potential applications in various chemical and pharmaceutical contexts.
Formula:C6H5F2N
InChI:InChI=1S/C6H5F2N/c7-6(8)5-3-1-2-4-9-5/h1-4,6H
InChI key:KUHSAAHTEMAJTF-UHFFFAOYSA-N
SMILES:C1=CC=NC(=C1)C(F)F
Found 3 products.