CymitQuimica logo

CAS 114468-03-0

:

3-(1,1-Difluoroethyl)pyridine

Description:
3-(1,1-Difluoroethyl)pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the 1,1-difluoroethyl group at the 3-position of the pyridine ring introduces unique chemical properties, including increased polarity and potential reactivity due to the electronegative fluorine atoms. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. The difluoroethyl substituent can influence the compound's behavior in chemical reactions, particularly in nucleophilic substitution and electrophilic aromatic substitution processes. Additionally, due to the presence of fluorine, it may exhibit distinct characteristics in terms of volatility and lipophilicity compared to its non-fluorinated counterparts. Safety data should be consulted for handling, as fluorinated compounds can pose specific health and environmental risks.
Formula:C7H7F2N
InChI:InChI=1S/C7H7F2N/c1-7(8,9)6-3-2-4-10-5-6/h2-5H,1H3
InChI key:InChIKey=WFCYXXQJORJHPH-UHFFFAOYSA-N
SMILES:C(C)(F)(F)C=1C=CC=NC1
Synonyms:
  • Pyridine, 3-(1,1-difluoroethyl)-
  • 3-(1,1-Difluoroethyl)pyridine
Found 3 products.